C14H25BrO6 — CID 71375788
diethyl 2-(3-bromopropyl)-2-(2,2-dimethoxyethyl)propanedioate (PubChem CID 71375788) has the molecular formula C14H25BrO6 and a molecular weight of 369.25 g/mol. Its IUPAC name is diethyl 2-(3-bromopropyl)-2-(2,2-dimethoxyethyl)propanedioate.
| Compound Name | diethyl 2-(3-bromopropyl)-2-(2,2-dimethoxyethyl)propanedioate |
|---|---|
| PubChem CID | 71375788 |
| Molecular Formula | C14H25BrO6 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | diethyl 2-(3-bromopropyl)-2-(2,2-dimethoxyethyl)propanedioate |
| SMILES | CCOC(=O)C(CCCBr)(CC(OC)OC)C(=O)OCC |
| InChI | InChI=1S/C14H25BrO6/c1-5-20-12(16)14(8-7-9-15,13(17)21-6-2)10-11(18-3)19-4/h11H,5-10H2,1-4H3 |
| InChIKey | PDJSGKBIJCJOOQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|