C13H21F3O6 — CID 172594741
diethyl 2-(2,2-dimethoxyethyl)-2-(2,2,2-trifluoroethyl)propanedioate (PubChem CID 172594741) has the molecular formula C13H21F3O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is diethyl 2-(2,2-dimethoxyethyl)-2-(2,2,2-trifluoroethyl)propanedioate.
| Compound Name | diethyl 2-(2,2-dimethoxyethyl)-2-(2,2,2-trifluoroethyl)propanedioate |
|---|---|
| PubChem CID | 172594741 |
| Molecular Formula | C13H21F3O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | diethyl 2-(2,2-dimethoxyethyl)-2-(2,2,2-trifluoroethyl)propanedioate |
| SMILES | CCOC(=O)C(CC(OC)OC)(CC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C13H21F3O6/c1-5-21-10(17)12(8-13(14,15)16,11(18)22-6-2)7-9(19-3)20-4/h9H,5-8H2,1-4H3 |
| InChIKey | SJTJYVQMIYCSLR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|