C13H24O5 — CID 113383104
2-ethoxycarbonyl-2-(2-methoxypropyl)-4-methylpentanoic acid (PubChem CID 113383104) has the molecular formula C13H24O5 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-(2-methoxypropyl)-4-methylpentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-(2-methoxypropyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 113383104 |
| Molecular Formula | C13H24O5 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-ethoxycarbonyl-2-(2-methoxypropyl)-4-methylpentanoic acid |
| SMILES | CCOC(=O)C(CC(C)C)(CC(C)OC)C(=O)O |
| InChI | InChI=1S/C13H24O5/c1-6-18-12(16)13(11(14)15,7-9(2)3)8-10(4)17-5/h9-10H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | XUSOCLJZKLTSIQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|