C11H19KO4 — CID 23672133
potassium 2-ethoxycarbonyl-2-ethyl-4-methylpentanoate (PubChem CID 23672133) has the molecular formula C11H19KO4 and a molecular weight of 254.37 g/mol. Its IUPAC name is potassium 2-ethoxycarbonyl-2-ethyl-4-methylpentanoate.
| Compound Name | potassium 2-ethoxycarbonyl-2-ethyl-4-methylpentanoate |
|---|---|
| PubChem CID | 23672133 |
| Molecular Formula | C11H19KO4 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | potassium 2-ethoxycarbonyl-2-ethyl-4-methylpentanoate |
| SMILES | CCOC(=O)C(CC)(CC(C)C)C(=O)[O-].[K+] |
| InChI | InChI=1S/C11H20O4.K/c1-5-11(9(12)13,7-8(3)4)10(14)15-6-2;/h8H,5-7H2,1-4H3,(H,12,13);/q;+1/p-1 |
| InChIKey | OZNXZIKGZDDJOJ-UHFFFAOYSA-M |
| XLogP | -2.25 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|