C13H27NO4 — CID 159438635
2-carboxy-2-ethyl-4-methylpentanoate;tetramethylazanium (PubChem CID 159438635) has the molecular formula C13H27NO4 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-carboxy-2-ethyl-4-methylpentanoate;tetramethylazanium.
| Compound Name | 2-carboxy-2-ethyl-4-methylpentanoate;tetramethylazanium |
|---|---|
| PubChem CID | 159438635 |
| Molecular Formula | C13H27NO4 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-carboxy-2-ethyl-4-methylpentanoate;tetramethylazanium |
| SMILES | CCC(CC(C)C)(C(=O)[O-])C(=O)O.C[N+](C)(C)C |
| InChI | InChI=1S/C9H16O4.C4H12N/c1-4-9(7(10)11,8(12)13)5-6(2)3;1-5(2,3)4/h6H,4-5H2,1-3H3,(H,10,11)(H,12,13);1-4H3/q;+1/p-1 |
| InChIKey | LRWWLFHFFHVWJF-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|