C9H16O3S — CID 174588607
(2S)-2-acetyl-4-methyl-2-(sulfanylmethyl)pentanoic acid (PubChem CID 174588607) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is (2S)-2-acetyl-4-methyl-2-(sulfanylmethyl)pentanoic acid.
| Compound Name | (2S)-2-acetyl-4-methyl-2-(sulfanylmethyl)pentanoic acid |
|---|---|
| PubChem CID | 174588607 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (2S)-2-acetyl-4-methyl-2-(sulfanylmethyl)pentanoic acid |
| SMILES | CC(=O)[C@@](CS)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C9H16O3S/c1-6(2)4-9(5-13,7(3)10)8(11)12/h6,13H,4-5H2,1-3H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | IUWLFCVMWQNXKD-VIFPVBQESA-N |
| XLogP | 1.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|