C9H17NO3S — CID 22315342
2-amino-2-(2-methylpropyl)-3-oxo-4-sulfanylpentanoic acid (PubChem CID 22315342) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 2-amino-2-(2-methylpropyl)-3-oxo-4-sulfanylpentanoic acid.
| Compound Name | 2-amino-2-(2-methylpropyl)-3-oxo-4-sulfanylpentanoic acid |
|---|---|
| PubChem CID | 22315342 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 2-amino-2-(2-methylpropyl)-3-oxo-4-sulfanylpentanoic acid |
| SMILES | CC(C)CC(N)(C(=O)O)C(=O)C(C)S |
| InChI | InChI=1S/C9H17NO3S/c1-5(2)4-9(10,8(12)13)7(11)6(3)14/h5-6,14H,4,10H2,1-3H3,(H,12,13) |
| InChIKey | PFBJJWFRBVHCBZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|