C14H28O2S — CID 57248485
2-tert-butylsulfanyl-4-methyl-2-(2-methylpropyl)pentanoic acid (PubChem CID 57248485) has the molecular formula C14H28O2S and a molecular weight of 260.44 g/mol. Its IUPAC name is 2-tert-butylsulfanyl-4-methyl-2-(2-methylpropyl)pentanoic acid.
| Compound Name | 2-tert-butylsulfanyl-4-methyl-2-(2-methylpropyl)pentanoic acid |
|---|---|
| PubChem CID | 57248485 |
| Molecular Formula | C14H28O2S |
| Molecular Weight | 260.44 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-tert-butylsulfanyl-4-methyl-2-(2-methylpropyl)pentanoic acid |
| SMILES | CC(C)CC(CC(C)C)(SC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H28O2S/c1-10(2)8-14(12(15)16,9-11(3)4)17-13(5,6)7/h10-11H,8-9H2,1-7H3,(H,15,16) |
| InChIKey | OXOMGPUISQHUFW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |