2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid

C9H18O3S — CID 114989364

IUPAC2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid
SMILESCC(C)CC(C)(SCCO)C(=O)O
InChIInChI=1S/C9H18O3S/c1-7(2)6-9(3,8(11)12)13-5-4-10/h7,10H,4-6H2,1-3H3,(H,11,12)
InChIKeyKEJCBDZXRSRHDF-UHFFFAOYSA-N
MW206.31 g/mol
LogP1.60
Rot. Bonds6

About 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid

2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid (PubChem CID 114989364) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid.

Molecular Properties

Compound Name2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid
PubChem CID114989364
Molecular FormulaC9H18O3S
Molecular Weight206.31 g/mol
Exact Mass206.10
IUPAC Name2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid
SMILESCC(C)CC(C)(SCCO)C(=O)O
InChIInChI=1S/C9H18O3S/c1-7(2)6-9(3,8(11)12)13-5-4-10/h7,10H,4-6H2,1-3H3,(H,11,12)
InChIKeyKEJCBDZXRSRHDF-UHFFFAOYSA-N
XLogP1.60
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.31
LogP ≤ 51.60
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid?
The IUPAC name of 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid (CID 114989364) is 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid.
What is the SMILES notation for 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid?
The canonical SMILES for 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid is CC(C)CC(C)(SCCO)C(=O)O.
What is the InChIKey of 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid?
The InChIKey is KEJCBDZXRSRHDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3S/c1-7(2)6-9(3,8(11)12)13-5-4-10/h7,10H,4-6H2,1-3H3,(H,11,12).
What are the key properties of 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid?
2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid has a molecular weight of 206.31 g/mol, XLogP of 1.60, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylsulfanyl)-2,4-dimethylpentanoic acid is sourced from PubChem (CID 114989364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).