C10H18N2O4 — CID 174408077
2,4-diamino-6-methyl-3-oxo-2-(2-oxoethyl)heptanoic acid (PubChem CID 174408077) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 2,4-diamino-6-methyl-3-oxo-2-(2-oxoethyl)heptanoic acid.
| Compound Name | 2,4-diamino-6-methyl-3-oxo-2-(2-oxoethyl)heptanoic acid |
|---|---|
| PubChem CID | 174408077 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2,4-diamino-6-methyl-3-oxo-2-(2-oxoethyl)heptanoic acid |
| SMILES | CC(C)CC(N)C(=O)C(N)(CC=O)C(=O)O |
| InChI | InChI=1S/C10H18N2O4/c1-6(2)5-7(11)8(14)10(12,3-4-13)9(15)16/h4,6-7H,3,5,11-12H2,1-2H3,(H,15,16) |
| InChIKey | OHJJHOYAXKBPJS-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 123.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|