C16H29N3O6 — CID 141485675
2,4,7-triamino-2,7-bis(2-methylpropyl)-3,6-dioxooctanedioic acid (PubChem CID 141485675) has the molecular formula C16H29N3O6 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2,4,7-triamino-2,7-bis(2-methylpropyl)-3,6-dioxooctanedioic acid.
| Compound Name | 2,4,7-triamino-2,7-bis(2-methylpropyl)-3,6-dioxooctanedioic acid |
|---|---|
| PubChem CID | 141485675 |
| Molecular Formula | C16H29N3O6 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 2,4,7-triamino-2,7-bis(2-methylpropyl)-3,6-dioxooctanedioic acid |
| SMILES | CC(C)CC(N)(C(=O)O)C(=O)CC(N)C(=O)C(N)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C16H29N3O6/c1-8(2)6-15(18,13(22)23)11(20)5-10(17)12(21)16(19,14(24)25)7-9(3)4/h8-10H,5-7,17-19H2,1-4H3,(H,22,23)(H,24,25) |
| InChIKey | LCLYSSGESCEUKX-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 186.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|