C9H19N3O4 — CID 141082630
(2R,4S)-2,4,8-triamino-2-(hydroxymethyl)-3-oxooctanoic acid (PubChem CID 141082630) has the molecular formula C9H19N3O4 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2R,4S)-2,4,8-triamino-2-(hydroxymethyl)-3-oxooctanoic acid.
| Compound Name | (2R,4S)-2,4,8-triamino-2-(hydroxymethyl)-3-oxooctanoic acid |
|---|---|
| PubChem CID | 141082630 |
| Molecular Formula | C9H19N3O4 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2R,4S)-2,4,8-triamino-2-(hydroxymethyl)-3-oxooctanoic acid |
| SMILES | NCCCC[C@H](N)C(=O)[C@](N)(CO)C(=O)O |
| InChI | InChI=1S/C9H19N3O4/c10-4-2-1-3-6(11)7(14)9(12,5-13)8(15)16/h6,13H,1-5,10-12H2,(H,15,16)/t6-,9+/m0/s1 |
| InChIKey | VUNVESOTKAFOOX-IMTBSYHQSA-N |
| XLogP | -2.21 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|