C13H17N3O4 — CID 174352242
2,4,6-triamino-2-benzyl-3,6-dioxohexanoic acid (PubChem CID 174352242) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2,4,6-triamino-2-benzyl-3,6-dioxohexanoic acid.
| Compound Name | 2,4,6-triamino-2-benzyl-3,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 174352242 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2,4,6-triamino-2-benzyl-3,6-dioxohexanoic acid |
| SMILES | NC(=O)CC(N)C(=O)C(N)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17N3O4/c14-9(6-10(15)17)11(18)13(16,12(19)20)7-8-4-2-1-3-5-8/h1-5,9H,6-7,14,16H2,(H2,15,17)(H,19,20) |
| InChIKey | QJPQULGSYRJUGJ-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|