C14H19ClN2O5 — CID 67791111
(2R,4S)-4-amino-2-benzyl-2-(methylamino)-3-oxohexanedioic acid;hydrochloride (PubChem CID 67791111) has the molecular formula C14H19ClN2O5 and a molecular weight of 330.77 g/mol. Its IUPAC name is (2R,4S)-4-amino-2-benzyl-2-(methylamino)-3-oxohexanedioic acid;hydrochloride.
| Compound Name | (2R,4S)-4-amino-2-benzyl-2-(methylamino)-3-oxohexanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 67791111 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (2R,4S)-4-amino-2-benzyl-2-(methylamino)-3-oxohexanedioic acid;hydrochloride |
| SMILES | CN[C@@](Cc1ccccc1)(C(=O)O)C(=O)[C@@H](N)CC(=O)O.Cl |
| InChI | InChI=1S/C14H18N2O5.ClH/c1-16-14(13(20)21,8-9-5-3-2-4-6-9)12(19)10(15)7-11(17)18;/h2-6,10,16H,7-8,15H2,1H3,(H,17,18)(H,20,21);1H/t10-,14+;/m0./s1 |
| InChIKey | ZHXFGHDBYWIMAZ-IMVWOWLCSA-N |
| XLogP | 0.06 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|