C11H16ClNO2 — CID 66988599
(2S)-2-methyl-2-(methylamino)-3-phenylpropanoic acid;hydrochloride (PubChem CID 66988599) has the molecular formula C11H16ClNO2 and a molecular weight of 229.71 g/mol. Its IUPAC name is (2S)-2-methyl-2-(methylamino)-3-phenylpropanoic acid;hydrochloride.
| Compound Name | (2S)-2-methyl-2-(methylamino)-3-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66988599 |
| Molecular Formula | C11H16ClNO2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (2S)-2-methyl-2-(methylamino)-3-phenylpropanoic acid;hydrochloride |
| SMILES | CN[C@@](C)(Cc1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C11H15NO2.ClH/c1-11(12-2,10(13)14)8-9-6-4-3-5-7-9;/h3-7,12H,8H2,1-2H3,(H,13,14);1H/t11-;/m0./s1 |
| InChIKey | HXBIEUYUVPFXIX-MERQFXBCSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |