C11H14ClNO2 — CID 24978280
3-(4-chlorophenyl)-2-methyl-2-(methylamino)propanoic acid (PubChem CID 24978280) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-methyl-2-(methylamino)propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-methyl-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 24978280 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-(4-chlorophenyl)-2-methyl-2-(methylamino)propanoic acid |
| SMILES | CNC(C)(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C11H14ClNO2/c1-11(13-2,10(14)15)7-8-3-5-9(12)6-4-8/h3-6,13H,7H2,1-2H3,(H,14,15) |
| InChIKey | JPPNJDLQNXGENS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |