C11H15NO3 — CID 87409389
(2S)-2-[deuterio(methyl)amino]-3-(4-hydroxyphenyl)-2-methylpropanoic acid (PubChem CID 87409389) has the molecular formula C11H15NO3 and a molecular weight of 210.25 g/mol. Its IUPAC name is (2S)-2-[deuterio(methyl)amino]-3-(4-hydroxyphenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-[deuterio(methyl)amino]-3-(4-hydroxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87409389 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (2S)-2-[deuterio(methyl)amino]-3-(4-hydroxyphenyl)-2-methylpropanoic acid |
| SMILES | [2H]N(C)[C@@](C)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-11(12-2,10(14)15)7-8-3-5-9(13)6-4-8/h3-6,12-13H,7H2,1-2H3,(H,14,15)/t11-/m0/s1/i/hD |
| InChIKey | UNNSTJCHJFWDSF-LPBHISBCSA-N |
| XLogP | 1.00 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |