C21H22N2O7 — CID 139640464
(2R,5S)-5-amino-2-benzyl-2-[[2-(4-hydroxyphenyl)acetyl]amino]-3-oxohexanedioic acid (PubChem CID 139640464) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is (2R,5S)-5-amino-2-benzyl-2-[[2-(4-hydroxyphenyl)acetyl]amino]-3-oxohexanedioic acid.
| Compound Name | (2R,5S)-5-amino-2-benzyl-2-[[2-(4-hydroxyphenyl)acetyl]amino]-3-oxohexanedioic acid |
|---|---|
| PubChem CID | 139640464 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (2R,5S)-5-amino-2-benzyl-2-[[2-(4-hydroxyphenyl)acetyl]amino]-3-oxohexanedioic acid |
| SMILES | N[C@@H](CC(=O)[C@@](Cc1ccccc1)(NC(=O)Cc1ccc(O)cc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H22N2O7/c22-16(19(27)28)11-17(25)21(20(29)30,12-14-4-2-1-3-5-14)23-18(26)10-13-6-8-15(24)9-7-13/h1-9,16,24H,10-12,22H2,(H,23,26)(H,27,28)(H,29,30)/t16-,21+/m0/s1 |
| InChIKey | ZVUQUEPSBUSPRI-HRAATJIYSA-N |
| XLogP | 0.49 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|