C18H21NO6 — CID 121320325
(2S)-2-amino-3-phenylpropanoic acid;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 121320325) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 121320325 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)O.O=C(O)C(O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H11NO2.C9H10O4/c10-8(9(11)12)6-7-4-2-1-3-5-7;10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-5,8H,6,10H2,(H,11,12);1-4,8,10-11H,5H2,(H,12,13)/t8-;/m0./s1 |
| InChIKey | ALWQKYWGTUWVDI-QRPNPIFTSA-N |
| XLogP | 1.02 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |