C18H24N2O6 — CID 157487068
(2S)-2-amino-3-(4-aminophenyl)propanoic acid;deuterium monohydride;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 157487068) has the molecular formula C18H24N2O6 and a molecular weight of 365.40 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-aminophenyl)propanoic acid;deuterium monohydride;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(4-aminophenyl)propanoic acid;deuterium monohydride;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 157487068 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | (2S)-2-amino-3-(4-aminophenyl)propanoic acid;deuterium monohydride;2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | Nc1ccc(C[C@H](N)C(=O)O)cc1.O=C(O)C(O)Cc1ccc(O)cc1.[H][2H] |
| InChI | InChI=1S/C9H12N2O2.C9H10O4.H2/c2*10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,10-11H2,(H,12,13);1-4,8,10-11H,5H2,(H,12,13);1H/t8-;;/m0../s1/i;;1+1 |
| InChIKey | BWVOQDRWYAEVDM-IGTPDLKTSA-N |
| XLogP | 0.85 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|