C13H18N2O7 — CID 57368433
(2S)-2-aminobutanedioic acid;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 57368433) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 57368433 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2S)-2-aminobutanedioic acid;(2S)-2-amino-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)O.N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C9H11NO3.C4H7NO4/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;5-2(4(8)9)1-3(6)7/h1-4,8,11H,5,10H2,(H,12,13);2H,1,5H2,(H,6,7)(H,8,9)/t8-;2-/m00/s1 |
| InChIKey | HBBVDTCKIJRNTE-VWURTLBMSA-N |
| XLogP | -0.78 |
| TPSA | 184.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |