C20H23NO4 — CID 68843476
(2S)-2-[(4-hydroxyphenyl)methyl]-2-(3-phenylpropanoylamino)butanoic acid (PubChem CID 68843476) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is (2S)-2-[(4-hydroxyphenyl)methyl]-2-(3-phenylpropanoylamino)butanoic acid.
| Compound Name | (2S)-2-[(4-hydroxyphenyl)methyl]-2-(3-phenylpropanoylamino)butanoic acid |
|---|---|
| PubChem CID | 68843476 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (2S)-2-[(4-hydroxyphenyl)methyl]-2-(3-phenylpropanoylamino)butanoic acid |
| SMILES | CC[C@@](Cc1ccc(O)cc1)(NC(=O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H23NO4/c1-2-20(19(24)25,14-16-8-11-17(22)12-9-16)21-18(23)13-10-15-6-4-3-5-7-15/h3-9,11-12,22H,2,10,13-14H2,1H3,(H,21,23)(H,24,25)/t20-/m0/s1 |
| InChIKey | BGOYGIBLTIAQDC-FQEVSTJZSA-N |
| XLogP | 2.92 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |