C13H19NO4 — CID 79807068
2-ethyl-2-[3-(furan-2-yl)propanoylamino]butanoic acid (PubChem CID 79807068) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-ethyl-2-[3-(furan-2-yl)propanoylamino]butanoic acid.
| Compound Name | 2-ethyl-2-[3-(furan-2-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 79807068 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-ethyl-2-[3-(furan-2-yl)propanoylamino]butanoic acid |
| SMILES | CCC(CC)(NC(=O)CCc1ccco1)C(=O)O |
| InChI | InChI=1S/C13H19NO4/c1-3-13(4-2,12(16)17)14-11(15)8-7-10-6-5-9-18-10/h5-6,9H,3-4,7-8H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | VAZJMJHZKIPKKY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |