C15H22N4O4 — CID 67130810
2,4-diamino-2-[3-(carbamoylamino)propyl]-3-oxo-5-phenylpentanoic acid (PubChem CID 67130810) has the molecular formula C15H22N4O4 and a molecular weight of 322.37 g/mol. Its IUPAC name is 2,4-diamino-2-[3-(carbamoylamino)propyl]-3-oxo-5-phenylpentanoic acid.
| Compound Name | 2,4-diamino-2-[3-(carbamoylamino)propyl]-3-oxo-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 67130810 |
| Molecular Formula | C15H22N4O4 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 2,4-diamino-2-[3-(carbamoylamino)propyl]-3-oxo-5-phenylpentanoic acid |
| SMILES | NC(=O)NCCCC(N)(C(=O)O)C(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C15H22N4O4/c16-11(9-10-5-2-1-3-6-10)12(20)15(18,13(21)22)7-4-8-19-14(17)23/h1-3,5-6,11H,4,7-9,16,18H2,(H,21,22)(H3,17,19,23) |
| InChIKey | LKAQFOYYGONHQW-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|