C10H14ClN3O2 — CID 140515646
2,3-diamino-2-benzyl-3-iminopropanoic acid;hydrochloride (PubChem CID 140515646) has the molecular formula C10H14ClN3O2 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2,3-diamino-2-benzyl-3-iminopropanoic acid;hydrochloride.
| Compound Name | 2,3-diamino-2-benzyl-3-iminopropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 140515646 |
| Molecular Formula | C10H14ClN3O2 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2,3-diamino-2-benzyl-3-iminopropanoic acid;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(N)(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C10H13N3O2.ClH/c11-8(12)10(13,9(14)15)6-7-4-2-1-3-5-7;/h1-5H,6,13H2,(H3,11,12)(H,14,15);1H |
| InChIKey | XPLRQPSJWAZCLC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|