C4H10N4O2 — CID 123261205
2,3-diamino-2-(aminomethyl)-3-iminopropanoic acid (PubChem CID 123261205) has the molecular formula C4H10N4O2 and a molecular weight of 146.15 g/mol. Its IUPAC name is 2,3-diamino-2-(aminomethyl)-3-iminopropanoic acid.
| Compound Name | 2,3-diamino-2-(aminomethyl)-3-iminopropanoic acid |
|---|---|
| PubChem CID | 123261205 |
| Molecular Formula | C4H10N4O2 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,3-diamino-2-(aminomethyl)-3-iminopropanoic acid |
| SMILES | [H]/N=C(\N)C(N)(CN)C(=O)O |
| InChI | InChI=1S/C4H10N4O2/c5-1-4(8,2(6)7)3(9)10/h1,5,8H2,(H3,6,7)(H,9,10) |
| InChIKey | WLDUYPKUKOMKTA-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|