C16H24N2O5S — CID 69285678
(2R)-2-amino-2-benzyl-3-oxobutanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid (PubChem CID 69285678) has the molecular formula C16H24N2O5S and a molecular weight of 356.44 g/mol. Its IUPAC name is (2R)-2-amino-2-benzyl-3-oxobutanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-amino-2-benzyl-3-oxobutanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 69285678 |
| Molecular Formula | C16H24N2O5S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | (2R)-2-amino-2-benzyl-3-oxobutanoic acid;(2S)-2-amino-4-methylsulfanylbutanoic acid |
| SMILES | CC(=O)[C@](N)(Cc1ccccc1)C(=O)O.CSCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C11H13NO3.C5H11NO2S/c1-8(13)11(12,10(14)15)7-9-5-3-2-4-6-9;1-9-3-2-4(6)5(7)8/h2-6H,7,12H2,1H3,(H,14,15);4H,2-3,6H2,1H3,(H,7,8)/t11-;4-/m10/s1 |
| InChIKey | URYAHYRBPJNUEN-PPXKCNQSSA-N |
| XLogP | 0.75 |
| TPSA | 143.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|