C12H22N4O6S2 — CID 88519440
(2R,4S)-2,4-diamino-2-[[[(2R,4S)-2,4-diamino-2-carboxy-3-oxopentyl]disulfanyl]methyl]-3-oxopentanoic acid (PubChem CID 88519440) has the molecular formula C12H22N4O6S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (2R,4S)-2,4-diamino-2-[[[(2R,4S)-2,4-diamino-2-carboxy-3-oxopentyl]disulfanyl]methyl]-3-oxopentanoic acid.
| Compound Name | (2R,4S)-2,4-diamino-2-[[[(2R,4S)-2,4-diamino-2-carboxy-3-oxopentyl]disulfanyl]methyl]-3-oxopentanoic acid |
|---|---|
| PubChem CID | 88519440 |
| Molecular Formula | C12H22N4O6S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2R,4S)-2,4-diamino-2-[[[(2R,4S)-2,4-diamino-2-carboxy-3-oxopentyl]disulfanyl]methyl]-3-oxopentanoic acid |
| SMILES | C[C@H](N)C(=O)[C@](N)(CSSC[C@](N)(C(=O)O)C(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C12H22N4O6S2/c1-5(13)7(17)11(15,9(19)20)3-23-24-4-12(16,10(21)22)8(18)6(2)14/h5-6H,3-4,13-16H2,1-2H3,(H,19,20)(H,21,22)/t5-,6-,11+,12+/m0/s1 |
| InChIKey | ZXDCFJCROFATDG-KUGABMNMSA-N |
| XLogP | -2.24 |
| TPSA | 212.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|