C12H23N3O5S2 — CID 88641047
(2R,4S)-2,4-diamino-2-[[[(2R)-2-amino-2-carboxyethyl]disulfanyl]methyl]-5-methyl-3-oxoheptanoic acid (PubChem CID 88641047) has the molecular formula C12H23N3O5S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (2R,4S)-2,4-diamino-2-[[[(2R)-2-amino-2-carboxyethyl]disulfanyl]methyl]-5-methyl-3-oxoheptanoic acid.
| Compound Name | (2R,4S)-2,4-diamino-2-[[[(2R)-2-amino-2-carboxyethyl]disulfanyl]methyl]-5-methyl-3-oxoheptanoic acid |
|---|---|
| PubChem CID | 88641047 |
| Molecular Formula | C12H23N3O5S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2R,4S)-2,4-diamino-2-[[[(2R)-2-amino-2-carboxyethyl]disulfanyl]methyl]-5-methyl-3-oxoheptanoic acid |
| SMILES | CCC(C)[C@H](N)C(=O)[C@](N)(CSSC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H23N3O5S2/c1-3-6(2)8(14)9(16)12(15,11(19)20)5-22-21-4-7(13)10(17)18/h6-8H,3-5,13-15H2,1-2H3,(H,17,18)(H,19,20)/t6?,7-,8-,12+/m0/s1 |
| InChIKey | OBYBSLBBRLWCEP-ADEBKYASSA-N |
| XLogP | -0.50 |
| TPSA | 169.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|