C8H18Cl2N2O4S2 — CID 175936776
(2R)-2-amino-3-[[(2R)-2-amino-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid;dihydrochloride (PubChem CID 175936776) has the molecular formula C8H18Cl2N2O4S2 and a molecular weight of 341.28 g/mol. Its IUPAC name is (2R)-2-amino-3-[[(2R)-2-amino-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid;dihydrochloride.
| Compound Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 175936776 |
| Molecular Formula | C8H18Cl2N2O4S2 |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (2R)-2-amino-3-[[(2R)-2-amino-2-carboxypropyl]disulfanyl]-2-methylpropanoic acid;dihydrochloride |
| SMILES | C[C@](N)(CSSC[C@](C)(N)C(=O)O)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H16N2O4S2.2ClH/c1-7(9,5(11)12)3-15-16-4-8(2,10)6(13)14;;/h3-4,9-10H2,1-2H3,(H,11,12)(H,13,14);2*1H/t7-,8-;;/m0../s1 |
| InChIKey | DFTMSNATIQLMNH-FOMWZSOGSA-N |
| XLogP | 0.82 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|