C6H11NO4Se — CID 172765820
[[(2R)-2-amino-2-carboxypropyl]-methylselaniumyl]formate (PubChem CID 172765820) has the molecular formula C6H11NO4Se and a molecular weight of 240.12 g/mol. Its IUPAC name is [[(2R)-2-amino-2-carboxypropyl]-methylselaniumyl]formate.
| Compound Name | [[(2R)-2-amino-2-carboxypropyl]-methylselaniumyl]formate |
|---|---|
| PubChem CID | 172765820 |
| Molecular Formula | C6H11NO4Se |
| Molecular Weight | 240.12 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | [[(2R)-2-amino-2-carboxypropyl]-methylselaniumyl]formate |
| SMILES | C[Se+](C[C@](C)(N)C(=O)O)C(=O)[O-] |
| InChI | InChI=1S/C6H11NO4Se/c1-6(7,4(8)9)3-12(2)5(10)11/h3,7H2,1-2H3,(H-,8,9,10,11)/t6-,12?/m0/s1 |
| InChIKey | MHJZPXCFWARWCH-RLWMBFFFSA-N |
| XLogP | -1.16 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.12 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|