C11H21N3O6P+ — CID 88517378
[2-carboxy-2-[[(2R,4S)-2,4-diamino-3-oxo-2-propylpentanoyl]amino]ethyl]-hydroxy-oxophosphanium (PubChem CID 88517378) has the molecular formula C11H21N3O6P+ and a molecular weight of 322.28 g/mol. Its IUPAC name is [2-carboxy-2-[[(2R,4S)-2,4-diamino-3-oxo-2-propylpentanoyl]amino]ethyl]-hydroxy-oxophosphanium.
| Compound Name | [2-carboxy-2-[[(2R,4S)-2,4-diamino-3-oxo-2-propylpentanoyl]amino]ethyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 88517378 |
| Molecular Formula | C11H21N3O6P+ |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [2-carboxy-2-[[(2R,4S)-2,4-diamino-3-oxo-2-propylpentanoyl]amino]ethyl]-hydroxy-oxophosphanium |
| SMILES | CCC[C@](N)(C(=O)NC(C[P+](=O)O)C(=O)O)C(=O)[C@H](C)N |
| InChI | InChI=1S/C11H20N3O6P/c1-3-4-11(13,8(15)6(2)12)10(18)14-7(9(16)17)5-21(19)20/h6-7H,3-5,12-13H2,1-2H3,(H2-,14,16,17,18,19,20)/p+1/t6-,7?,11+/m0/s1 |
| InChIKey | ACPJGBVDNRIRCP-NSMOOJLNSA-O |
| XLogP | -1.30 |
| TPSA | 172.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|