C9H14O6 — CID 23423170
1-methylpentane-1,3,3-tricarboxylic acid (PubChem CID 23423170) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is 1-methylpentane-1,3,3-tricarboxylic acid.
| Compound Name | 1-methylpentane-1,3,3-tricarboxylic acid |
|---|---|
| PubChem CID | 23423170 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-methylpentane-1,3,3-tricarboxylic acid |
| SMILES | CCC(CC(C)C(=O)O)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O6/c1-3-9(7(12)13,8(14)15)4-5(2)6(10)11/h5H,3-4H2,1-2H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | BTLDGSNAZISUJV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|