C32H60O8 — CID 174921686
diethyl 2,2-ditert-butylpropanedioate;dipropyl 2,2-bis(2-methylpropyl)propanedioate (PubChem CID 174921686) has the molecular formula C32H60O8 and a molecular weight of 572.82 g/mol. Its IUPAC name is diethyl 2,2-ditert-butylpropanedioate;dipropyl 2,2-bis(2-methylpropyl)propanedioate.
| Compound Name | diethyl 2,2-ditert-butylpropanedioate;dipropyl 2,2-bis(2-methylpropyl)propanedioate |
|---|---|
| PubChem CID | 174921686 |
| Molecular Formula | C32H60O8 |
| Molecular Weight | 572.82 g/mol |
| Exact Mass | 572.43 |
| IUPAC Name | diethyl 2,2-ditert-butylpropanedioate;dipropyl 2,2-bis(2-methylpropyl)propanedioate |
| SMILES | CCCOC(=O)C(CC(C)C)(CC(C)C)C(=O)OCCC.CCOC(=O)C(C(=O)OCC)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H32O4.C15H28O4/c1-7-9-20-15(18)17(11-13(3)4,12-14(5)6)16(19)21-10-8-2;1-9-18-11(16)15(13(3,4)5,14(6,7)8)12(17)19-10-2/h13-14H,7-12H2,1-6H3;9-10H2,1-8H3 |
| InChIKey | OOHNECMXYRRITM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.82 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|