C14H26O6 — CID 103973962
5-ethoxy-2-ethoxycarbonyl-4-hydroxy-2-(2-methylpropyl)pentanoic acid (PubChem CID 103973962) has the molecular formula C14H26O6 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-ethoxy-2-ethoxycarbonyl-4-hydroxy-2-(2-methylpropyl)pentanoic acid.
| Compound Name | 5-ethoxy-2-ethoxycarbonyl-4-hydroxy-2-(2-methylpropyl)pentanoic acid |
|---|---|
| PubChem CID | 103973962 |
| Molecular Formula | C14H26O6 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-ethoxy-2-ethoxycarbonyl-4-hydroxy-2-(2-methylpropyl)pentanoic acid |
| SMILES | CCOCC(O)CC(CC(C)C)(C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C14H26O6/c1-5-19-9-11(15)8-14(12(16)17,7-10(3)4)13(18)20-6-2/h10-11,15H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | NTCDAGFKAMQJDL-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|