C12H19F3O5 — CID 106706790
2-ethoxycarbonyl-4-methyl-2-(2,2,2-trifluoroethoxymethyl)pentanoic acid (PubChem CID 106706790) has the molecular formula C12H19F3O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-methyl-2-(2,2,2-trifluoroethoxymethyl)pentanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-methyl-2-(2,2,2-trifluoroethoxymethyl)pentanoic acid |
|---|---|
| PubChem CID | 106706790 |
| Molecular Formula | C12H19F3O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-ethoxycarbonyl-4-methyl-2-(2,2,2-trifluoroethoxymethyl)pentanoic acid |
| SMILES | CCOC(=O)C(COCC(F)(F)F)(CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H19F3O5/c1-4-20-10(18)11(9(16)17,5-8(2)3)6-19-7-12(13,14)15/h8H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | KPWIYCDBSUQJRY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|