C10H15F3O5 — CID 103974538
2-ethoxycarbonyl-2-ethyl-5,5,5-trifluoro-4-hydroxypentanoic acid (PubChem CID 103974538) has the molecular formula C10H15F3O5 and a molecular weight of 272.22 g/mol. Its IUPAC name is 2-ethoxycarbonyl-2-ethyl-5,5,5-trifluoro-4-hydroxypentanoic acid.
| Compound Name | 2-ethoxycarbonyl-2-ethyl-5,5,5-trifluoro-4-hydroxypentanoic acid |
|---|---|
| PubChem CID | 103974538 |
| Molecular Formula | C10H15F3O5 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-ethoxycarbonyl-2-ethyl-5,5,5-trifluoro-4-hydroxypentanoic acid |
| SMILES | CCOC(=O)C(CC)(CC(O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H15F3O5/c1-3-9(7(15)16,8(17)18-4-2)5-6(14)10(11,12)13/h6,14H,3-5H2,1-2H3,(H,15,16) |
| InChIKey | ZWECIOKZITYWAN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|