C12H18F4O4 — CID 91734908
1-O-ethyl 3-O-(2,2,3,3-tetrafluoropropyl) 2,2-diethylpropanedioate (PubChem CID 91734908) has the molecular formula C12H18F4O4 and a molecular weight of 302.26 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(2,2,3,3-tetrafluoropropyl) 2,2-diethylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-(2,2,3,3-tetrafluoropropyl) 2,2-diethylpropanedioate |
|---|---|
| PubChem CID | 91734908 |
| Molecular Formula | C12H18F4O4 |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-O-ethyl 3-O-(2,2,3,3-tetrafluoropropyl) 2,2-diethylpropanedioate |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H18F4O4/c1-4-11(5-2,9(17)19-6-3)10(18)20-7-12(15,16)8(13)14/h8H,4-7H2,1-3H3 |
| InChIKey | VSXKDZXOSMMMKI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|