C22H38F4O4 — CID 90942057
(1-methylcyclohexyl) 2,2-dimethylbutanoate;2,2,3,3-tetrafluoropropyl 2,2-dimethylbutanoate (PubChem CID 90942057) has the molecular formula C22H38F4O4 and a molecular weight of 442.53 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2,2-dimethylbutanoate;2,2,3,3-tetrafluoropropyl 2,2-dimethylbutanoate.
| Compound Name | (1-methylcyclohexyl) 2,2-dimethylbutanoate;2,2,3,3-tetrafluoropropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90942057 |
| Molecular Formula | C22H38F4O4 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | (1-methylcyclohexyl) 2,2-dimethylbutanoate;2,2,3,3-tetrafluoropropyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCCCC1.CCC(C)(C)C(=O)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C13H24O2.C9H14F4O2/c1-5-12(2,3)11(14)15-13(4)9-7-6-8-10-13;1-4-8(2,3)7(14)15-5-9(12,13)6(10)11/h5-10H2,1-4H3;6H,4-5H2,1-3H3 |
| InChIKey | FNTIAXDZTGNUOZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|