C14H26O2 — CID 148692117
(1-methylcyclopentyl) 2,2,4-trimethylpentanoate (PubChem CID 148692117) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (1-methylcyclopentyl) 2,2,4-trimethylpentanoate.
| Compound Name | (1-methylcyclopentyl) 2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 148692117 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (1-methylcyclopentyl) 2,2,4-trimethylpentanoate |
| SMILES | CC(C)CC(C)(C)C(=O)OC1(C)CCCC1 |
| InChI | InChI=1S/C14H26O2/c1-11(2)10-13(3,4)12(15)16-14(5)8-6-7-9-14/h11H,6-10H2,1-5H3 |
| InChIKey | NTROFXBHPTXLAS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |