C12H22O4S — CID 165070592
(4-methyl-1,1-dioxothian-4-yl) 2,2-dimethylbutanoate (PubChem CID 165070592) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is (4-methyl-1,1-dioxothian-4-yl) 2,2-dimethylbutanoate.
| Compound Name | (4-methyl-1,1-dioxothian-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 165070592 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (4-methyl-1,1-dioxothian-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H22O4S/c1-5-11(2,3)10(13)16-12(4)6-8-17(14,15)9-7-12/h5-9H2,1-4H3 |
| InChIKey | FGFMBEOTCVEBKG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |