C15H30O2 — CID 158051105
methane;(1-methylcyclohex-3-en-1-yl) 2,2-dimethylbutanoate (PubChem CID 158051105) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is methane;(1-methylcyclohex-3-en-1-yl) 2,2-dimethylbutanoate.
| Compound Name | methane;(1-methylcyclohex-3-en-1-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 158051105 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | methane;(1-methylcyclohex-3-en-1-yl) 2,2-dimethylbutanoate |
| SMILES | C.C.CCC(C)(C)C(=O)OC1(C)CC=CCC1 |
| InChI | InChI=1S/C13H22O2.2CH4/c1-5-12(2,3)11(14)15-13(4)9-7-6-8-10-13;;/h6-7H,5,8-10H2,1-4H3;2*1H4 |
| InChIKey | FJMNJXWQDBRXNA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|