C15H28O2 — CID 123317170
(1-methylcyclohexyl) 2,3,3-trimethylpentanoate (PubChem CID 123317170) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2,3,3-trimethylpentanoate.
| Compound Name | (1-methylcyclohexyl) 2,3,3-trimethylpentanoate |
|---|---|
| PubChem CID | 123317170 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (1-methylcyclohexyl) 2,3,3-trimethylpentanoate |
| SMILES | CCC(C)(C)C(C)C(=O)OC1(C)CCCCC1 |
| InChI | InChI=1S/C15H28O2/c1-6-14(3,4)12(2)13(16)17-15(5)10-8-7-9-11-15/h12H,6-11H2,1-5H3 |
| InChIKey | UFXTWXMBCVJLEF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |