About (1-methylcyclohexyl) acetate;propane
(1-methylcyclohexyl) acetate;propane (PubChem CID 143035856) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is (1-methylcyclohexyl) acetate;propane.
Molecular Properties
| Compound Name | (1-methylcyclohexyl) acetate;propane |
| PubChem CID | 143035856 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (1-methylcyclohexyl) acetate;propane |
| SMILES | CC(=O)OC1(C)CCCCC1.CCC |
| InChI | InChI=1S/C9H16O2.C3H8/c1-8(10)11-9(2)6-4-3-5-7-9;1-3-2/h3-7H2,1-2H3;3H2,1-2H3 |
| InChIKey | INHGUDLQEKJWRQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclohexyl) acetate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclohexyl) acetate;propane?
The IUPAC name of (1-methylcyclohexyl) acetate;propane (CID 143035856) is (1-methylcyclohexyl) acetate;propane.
What is the SMILES notation for (1-methylcyclohexyl) acetate;propane?
The canonical SMILES for (1-methylcyclohexyl) acetate;propane is CC(=O)OC1(C)CCCCC1.CCC.
What is the InChIKey of (1-methylcyclohexyl) acetate;propane?
The InChIKey is INHGUDLQEKJWRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C3H8/c1-8(10)11-9(2)6-4-3-5-7-9;1-3-2/h3-7H2,1-2H3;3H2,1-2H3.
What are the key properties of (1-methylcyclohexyl) acetate;propane?
(1-methylcyclohexyl) acetate;propane has a molecular weight of 200.32 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclohexyl) acetate;propane is sourced from PubChem (CID 143035856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).