About methyl (1-methylcycloheptyl) carbonate
methyl (1-methylcycloheptyl) carbonate (PubChem CID 172553116) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl (1-methylcycloheptyl) carbonate.
Molecular Properties
| Compound Name | methyl (1-methylcycloheptyl) carbonate |
| PubChem CID | 172553116 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | methyl (1-methylcycloheptyl) carbonate |
| SMILES | COC(=O)OC1(C)CCCCCC1 |
| InChI | InChI=1S/C10H18O3/c1-10(13-9(11)12-2)7-5-3-4-6-8-10/h3-8H2,1-2H3 |
| InChIKey | YDGGDXYVDGIDQL-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl (1-methylcycloheptyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1-methylcycloheptyl) carbonate?
The IUPAC name of methyl (1-methylcycloheptyl) carbonate (CID 172553116) is methyl (1-methylcycloheptyl) carbonate.
What is the SMILES notation for methyl (1-methylcycloheptyl) carbonate?
The canonical SMILES for methyl (1-methylcycloheptyl) carbonate is COC(=O)OC1(C)CCCCCC1.
What is the InChIKey of methyl (1-methylcycloheptyl) carbonate?
The InChIKey is YDGGDXYVDGIDQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-10(13-9(11)12-2)7-5-3-4-6-8-10/h3-8H2,1-2H3.
What are the key properties of methyl (1-methylcycloheptyl) carbonate?
methyl (1-methylcycloheptyl) carbonate has a molecular weight of 186.25 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1-methylcycloheptyl) carbonate is sourced from PubChem (CID 172553116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).