About 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate
3-methylbutan-2-yl (1-methylcyclohexyl) carbonate (PubChem CID 58096721) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate |
| PubChem CID | 58096721 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate |
| SMILES | CC(C)C(C)OC(=O)OC1(C)CCCCC1 |
| InChI | InChI=1S/C13H24O3/c1-10(2)11(3)15-12(14)16-13(4)8-6-5-7-9-13/h10-11H,5-9H2,1-4H3 |
| InChIKey | WPGJAJKLWXMDNW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate?
The IUPAC name of 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate (CID 58096721) is 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate.
What is the SMILES notation for 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate?
The canonical SMILES for 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate is CC(C)C(C)OC(=O)OC1(C)CCCCC1.
What is the InChIKey of 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate?
The InChIKey is WPGJAJKLWXMDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O3/c1-10(2)11(3)15-12(14)16-13(4)8-6-5-7-9-13/h10-11H,5-9H2,1-4H3.
What are the key properties of 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate?
3-methylbutan-2-yl (1-methylcyclohexyl) carbonate has a molecular weight of 228.33 g/mol, XLogP of 3.91, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl (1-methylcyclohexyl) carbonate is sourced from PubChem (CID 58096721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).