About (1-methylcyclobutyl) acetate
(1-methylcyclobutyl) acetate (PubChem CID 13396130) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is (1-methylcyclobutyl) acetate.
Molecular Properties
| Compound Name | (1-methylcyclobutyl) acetate |
| PubChem CID | 13396130 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (1-methylcyclobutyl) acetate |
| SMILES | CC(=O)OC1(C)CCC1 |
| InChI | InChI=1S/C7H12O2/c1-6(8)9-7(2)4-3-5-7/h3-5H2,1-2H3 |
| InChIKey | COECHZJTHZENSV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclobutyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclobutyl) acetate?
The IUPAC name of (1-methylcyclobutyl) acetate (CID 13396130) is (1-methylcyclobutyl) acetate.
What is the SMILES notation for (1-methylcyclobutyl) acetate?
The canonical SMILES for (1-methylcyclobutyl) acetate is CC(=O)OC1(C)CCC1.
What is the InChIKey of (1-methylcyclobutyl) acetate?
The InChIKey is COECHZJTHZENSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-6(8)9-7(2)4-3-5-7/h3-5H2,1-2H3.
What are the key properties of (1-methylcyclobutyl) acetate?
(1-methylcyclobutyl) acetate has a molecular weight of 128.17 g/mol, XLogP of 1.49, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclobutyl) acetate is sourced from PubChem (CID 13396130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).