About (1-formylcyclopropyl) acetate
(1-formylcyclopropyl) acetate (PubChem CID 155705215) has the molecular formula C6H8O3
and a molecular weight of 128.13 g/mol. Its IUPAC name is (1-formylcyclopropyl) acetate.
Molecular Properties
| Compound Name | (1-formylcyclopropyl) acetate |
| PubChem CID | 155705215 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.05 |
| IUPAC Name | (1-formylcyclopropyl) acetate |
| SMILES | CC(=O)OC1(C=O)CC1 |
| InChI | InChI=1S/C6H8O3/c1-5(8)9-6(4-7)2-3-6/h4H,2-3H2,1H3 |
| InChIKey | QYTMAAVTMUPQSY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (1-formylcyclopropyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-formylcyclopropyl) acetate?
The IUPAC name of (1-formylcyclopropyl) acetate (CID 155705215) is (1-formylcyclopropyl) acetate.
What is the SMILES notation for (1-formylcyclopropyl) acetate?
The canonical SMILES for (1-formylcyclopropyl) acetate is CC(=O)OC1(C=O)CC1.
What is the InChIKey of (1-formylcyclopropyl) acetate?
The InChIKey is QYTMAAVTMUPQSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8O3/c1-5(8)9-6(4-7)2-3-6/h4H,2-3H2,1H3.
What are the key properties of (1-formylcyclopropyl) acetate?
(1-formylcyclopropyl) acetate has a molecular weight of 128.13 g/mol, XLogP of 0.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-formylcyclopropyl) acetate is sourced from PubChem (CID 155705215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).