C15H22O7 — CID 173250012
(2,2-diacetyloxy-1-formylcyclooctyl) acetate (PubChem CID 173250012) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (2,2-diacetyloxy-1-formylcyclooctyl) acetate.
| Compound Name | (2,2-diacetyloxy-1-formylcyclooctyl) acetate |
|---|---|
| PubChem CID | 173250012 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (2,2-diacetyloxy-1-formylcyclooctyl) acetate |
| SMILES | CC(=O)OC1(C=O)CCCCCCC1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H22O7/c1-11(17)20-14(10-16)8-6-4-5-7-9-15(14,21-12(2)18)22-13(3)19/h10H,4-9H2,1-3H3 |
| InChIKey | SMLFPMDYONHVCT-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|