C16H31O2P — CID 166970108
(1-methylcyclohexyl) 2,4,4-trimethyl-2-methylphosphanylpentanoate (PubChem CID 166970108) has the molecular formula C16H31O2P and a molecular weight of 286.40 g/mol. Its IUPAC name is (1-methylcyclohexyl) 2,4,4-trimethyl-2-methylphosphanylpentanoate.
| Compound Name | (1-methylcyclohexyl) 2,4,4-trimethyl-2-methylphosphanylpentanoate |
|---|---|
| PubChem CID | 166970108 |
| Molecular Formula | C16H31O2P |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (1-methylcyclohexyl) 2,4,4-trimethyl-2-methylphosphanylpentanoate |
| SMILES | CPC(C)(CC(C)(C)C)C(=O)OC1(C)CCCCC1 |
| InChI | InChI=1S/C16H31O2P/c1-14(2,3)12-16(5,19-6)13(17)18-15(4)10-8-7-9-11-15/h19H,7-12H2,1-6H3 |
| InChIKey | HJXIODAPZCWWDO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|